About [(E)-1,3-bis(triphenylsilyl)prop-2-enyl]-triphenylsilane
[(E)-1,3-bis(triphenylsilyl)prop-2-enyl]-triphenylsilane (PubChem CID 6156392) has the molecular formula C57H48Si3
and a molecular weight of 817.27 g/mol. Its IUPAC name is [(E)-1,3-bis(triphenylsilyl)prop-2-enyl]-triphenylsilane.
Molecular Properties
| Compound Name | [(E)-1,3-bis(triphenylsilyl)prop-2-enyl]-triphenylsilane |
| PubChem CID | 6156392 |
| Molecular Formula | C57H48Si3 |
| Molecular Weight | 817.27 g/mol |
| Exact Mass | 816.31 |
| IUPAC Name | [(E)-1,3-bis(triphenylsilyl)prop-2-enyl]-triphenylsilane |
| SMILES | C(=C/[Si](c1ccccc1)(c1ccccc1)c1ccccc1)\C([Si](c1ccccc1)(c1ccccc1)c1ccccc1)[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C57H48Si3/c1-10-28-48(29-11-1)58(49-30-12-2-13-31-49,50-32-14-3-15-33-50)47-46-57(59(51-34-16-4-17-35-51,52-36-18-5-19-37-52)53-38-20-6-21-39-53)60(54-40-22-7-23-41-54,55-42-24-8-25-43-55)56-44-26-9-27-45-56/h1-47,57H/b47-46+ |
| InChIKey | GOFFODGDAAMMBY-CPHIHMHPSA-N |
| XLogP | 7.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 60 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 817.27 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze [(E)-1,3-bis(triphenylsilyl)prop-2-enyl]-triphenylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-1,3-bis(triphenylsilyl)prop-2-enyl]-triphenylsilane?
The IUPAC name of [(E)-1,3-bis(triphenylsilyl)prop-2-enyl]-triphenylsilane (CID 6156392) is [(E)-1,3-bis(triphenylsilyl)prop-2-enyl]-triphenylsilane.
What is the SMILES notation for [(E)-1,3-bis(triphenylsilyl)prop-2-enyl]-triphenylsilane?
The canonical SMILES for [(E)-1,3-bis(triphenylsilyl)prop-2-enyl]-triphenylsilane is C(=C/[Si](c1ccccc1)(c1ccccc1)c1ccccc1)\C([Si](c1ccccc1)(c1ccccc1)c1ccccc1)[Si](c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of [(E)-1,3-bis(triphenylsilyl)prop-2-enyl]-triphenylsilane?
The InChIKey is GOFFODGDAAMMBY-CPHIHMHPSA-N. The full InChI is InChI=1S/C57H48Si3/c1-10-28-48(29-11-1)58(49-30-12-2-13-31-49,50-32-14-3-15-33-50)47-46-57(59(51-34-16-4-17-35-51,52-36-18-5-19-37-52)53-38-20-6-21-39-53)60(54-40-22-7-23-41-54,55-42-24-8-25-43-55)56-44-26-9-27-45-56/h1-47,57H/b47-46+.
What are the key properties of [(E)-1,3-bis(triphenylsilyl)prop-2-enyl]-triphenylsilane?
[(E)-1,3-bis(triphenylsilyl)prop-2-enyl]-triphenylsilane has a molecular weight of 817.27 g/mol, XLogP of 7.50, 13 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-1,3-bis(triphenylsilyl)prop-2-enyl]-triphenylsilane is sourced from PubChem (CID 6156392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).