C25H29N3O2S2 — CID 6156866
(5Z)-3-butyl-2-(2,4-dimethylphenyl)imino-5-(3-ethyl-5-methoxy-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one (PubChem CID 6156866) has the molecular formula C25H29N3O2S2 and a molecular weight of 467.66 g/mol. Its IUPAC name is (5Z)-3-butyl-2-(2,4-dimethylphenyl)imino-5-(3-ethyl-5-methoxy-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-butyl-2-(2,4-dimethylphenyl)imino-5-(3-ethyl-5-methoxy-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 6156866 |
| Molecular Formula | C25H29N3O2S2 |
| Molecular Weight | 467.66 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | (5Z)-3-butyl-2-(2,4-dimethylphenyl)imino-5-(3-ethyl-5-methoxy-1,3-benzothiazol-2-ylidene)-1,3-thiazolidin-4-one |
| SMILES | CCCCN1C(=O)/C(=C2/Sc3ccc(OC)cc3N2CC)S/C1=N\c1ccc(C)cc1C |
| InChI | InChI=1S/C25H29N3O2S2/c1-6-8-13-28-23(29)22(32-25(28)26-19-11-9-16(3)14-17(19)4)24-27(7-2)20-15-18(30-5)10-12-21(20)31-24/h9-12,14-15H,6-8,13H2,1-5H3/b24-22-,26-25- |
| InChIKey | MIUBNCUAGOAVJB-SLJQUXCSSA-N |
| XLogP | 6.48 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.66 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|