C24H26N2O5 — CID 6157074
(5E)-1-butyl-5-[(2-hydroxy-3-methoxyphenyl)methylidene]-3-(2-phenylethyl)-1,3-diazinane-2,4,6-trione (PubChem CID 6157074) has the molecular formula C24H26N2O5 and a molecular weight of 422.48 g/mol. Its IUPAC name is (5E)-1-butyl-5-[(2-hydroxy-3-methoxyphenyl)methylidene]-3-(2-phenylethyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-1-butyl-5-[(2-hydroxy-3-methoxyphenyl)methylidene]-3-(2-phenylethyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 6157074 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | (5E)-1-butyl-5-[(2-hydroxy-3-methoxyphenyl)methylidene]-3-(2-phenylethyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CCCCN1C(=O)/C(=C\c2cccc(OC)c2O)C(=O)N(CCc2ccccc2)C1=O |
| InChI | InChI=1S/C24H26N2O5/c1-3-4-14-25-22(28)19(16-18-11-8-12-20(31-2)21(18)27)23(29)26(24(25)30)15-13-17-9-6-5-7-10-17/h5-12,16,27H,3-4,13-15H2,1-2H3/b19-16+ |
| InChIKey | JXMQAYWETIJBPR-KNTRCKAVSA-N |
| XLogP | 3.62 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|