About tributoxy(ethenyl)silane
tributoxy(ethenyl)silane (PubChem CID 615765) has the molecular formula C14H30O3Si
and a molecular weight of 274.48 g/mol. Its IUPAC name is tributoxy(ethenyl)silane.
Molecular Properties
| Compound Name | tributoxy(ethenyl)silane |
| PubChem CID | 615765 |
| Molecular Formula | C14H30O3Si |
| Molecular Weight | 274.48 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | tributoxy(ethenyl)silane |
| SMILES | C=C[Si](OCCCC)(OCCCC)OCCCC |
| InChI | InChI=1S/C14H30O3Si/c1-5-9-12-15-18(8-4,16-13-10-6-2)17-14-11-7-3/h8H,4-7,9-14H2,1-3H3 |
| InChIKey | SGCFZHOZKKQIBU-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.48 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tributoxy(ethenyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tributoxy(ethenyl)silane?
The IUPAC name of tributoxy(ethenyl)silane (CID 615765) is tributoxy(ethenyl)silane.
What is the SMILES notation for tributoxy(ethenyl)silane?
The canonical SMILES for tributoxy(ethenyl)silane is C=C[Si](OCCCC)(OCCCC)OCCCC.
What is the InChIKey of tributoxy(ethenyl)silane?
The InChIKey is SGCFZHOZKKQIBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30O3Si/c1-5-9-12-15-18(8-4,16-13-10-6-2)17-14-11-7-3/h8H,4-7,9-14H2,1-3H3.
What are the key properties of tributoxy(ethenyl)silane?
tributoxy(ethenyl)silane has a molecular weight of 274.48 g/mol, XLogP of 4.10, 13 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tributoxy(ethenyl)silane is sourced from PubChem (CID 615765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).