C21H19N3O2 — CID 615813
10-methyl-7,7-diphenyl-1,8,10-triazatricyclo[6.3.0.02,6]undec-5-ene-9,11-dione (PubChem CID 615813) has the molecular formula C21H19N3O2 and a molecular weight of 345.40 g/mol. Its IUPAC name is 10-methyl-7,7-diphenyl-1,8,10-triazatricyclo[6.3.0.02,6]undec-5-ene-9,11-dione.
| Compound Name | 10-methyl-7,7-diphenyl-1,8,10-triazatricyclo[6.3.0.02,6]undec-5-ene-9,11-dione |
|---|---|
| PubChem CID | 615813 |
| Molecular Formula | C21H19N3O2 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 10-methyl-7,7-diphenyl-1,8,10-triazatricyclo[6.3.0.02,6]undec-5-ene-9,11-dione |
| SMILES | Cn1c(=O)n2n(c1=O)C(c1ccccc1)(c1ccccc1)C1=CCCC12 |
| InChI | InChI=1S/C21H19N3O2/c1-22-19(25)23-18-14-8-13-17(18)21(24(23)20(22)26,15-9-4-2-5-10-15)16-11-6-3-7-12-16/h2-7,9-13,18H,8,14H2,1H3 |
| InChIKey | IJCKNOYOADUUBY-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|