About 2-(2-iodophenyl)-1,3-dihydrobenzo[f][1,3]benzoxazine
2-(2-iodophenyl)-1,3-dihydrobenzo[f][1,3]benzoxazine (PubChem CID 615816) has the molecular formula C18H14INO
and a molecular weight of 387.22 g/mol. Its IUPAC name is 2-(2-iodophenyl)-1,3-dihydrobenzo[f][1,3]benzoxazine.
Molecular Properties
| Compound Name | 2-(2-iodophenyl)-1,3-dihydrobenzo[f][1,3]benzoxazine |
| PubChem CID | 615816 |
| Molecular Formula | C18H14INO |
| Molecular Weight | 387.22 g/mol |
| Exact Mass | 387.01 |
| IUPAC Name | 2-(2-iodophenyl)-1,3-dihydrobenzo[f][1,3]benzoxazine |
| SMILES | Ic1ccccc1N1COc2ccc3ccccc3c2C1 |
| InChI | InChI=1S/C18H14INO/c19-16-7-3-4-8-17(16)20-11-15-14-6-2-1-5-13(14)9-10-18(15)21-12-20/h1-10H,11-12H2 |
| InChIKey | IAYPBPHLTYPYRH-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.22 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-iodophenyl)-1,3-dihydrobenzo[f][1,3]benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-iodophenyl)-1,3-dihydrobenzo[f][1,3]benzoxazine?
The IUPAC name of 2-(2-iodophenyl)-1,3-dihydrobenzo[f][1,3]benzoxazine (CID 615816) is 2-(2-iodophenyl)-1,3-dihydrobenzo[f][1,3]benzoxazine.
What is the SMILES notation for 2-(2-iodophenyl)-1,3-dihydrobenzo[f][1,3]benzoxazine?
The canonical SMILES for 2-(2-iodophenyl)-1,3-dihydrobenzo[f][1,3]benzoxazine is Ic1ccccc1N1COc2ccc3ccccc3c2C1.
What is the InChIKey of 2-(2-iodophenyl)-1,3-dihydrobenzo[f][1,3]benzoxazine?
The InChIKey is IAYPBPHLTYPYRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14INO/c19-16-7-3-4-8-17(16)20-11-15-14-6-2-1-5-13(14)9-10-18(15)21-12-20/h1-10H,11-12H2.
What are the key properties of 2-(2-iodophenyl)-1,3-dihydrobenzo[f][1,3]benzoxazine?
2-(2-iodophenyl)-1,3-dihydrobenzo[f][1,3]benzoxazine has a molecular weight of 387.22 g/mol, XLogP of 4.80, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-iodophenyl)-1,3-dihydrobenzo[f][1,3]benzoxazine is sourced from PubChem (CID 615816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).