About [(E)-(1,2,5-trimethylpiperidin-4-ylidene)amino] 4-fluorobenzoate
[(E)-(1,2,5-trimethylpiperidin-4-ylidene)amino] 4-fluorobenzoate (PubChem CID 6158230) has the molecular formula C15H19FN2O2
and a molecular weight of 278.33 g/mol. Its IUPAC name is [(E)-(1,2,5-trimethylpiperidin-4-ylidene)amino] 4-fluorobenzoate.
Molecular Properties
| Compound Name | [(E)-(1,2,5-trimethylpiperidin-4-ylidene)amino] 4-fluorobenzoate |
| PubChem CID | 6158230 |
| Molecular Formula | C15H19FN2O2 |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | [(E)-(1,2,5-trimethylpiperidin-4-ylidene)amino] 4-fluorobenzoate |
| SMILES | CC1CN(C)C(C)C/C1=N\OC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H19FN2O2/c1-10-9-18(3)11(2)8-14(10)17-20-15(19)12-4-6-13(16)7-5-12/h4-7,10-11H,8-9H2,1-3H3/b17-14+ |
| InChIKey | BBOGVVJGROGHRN-SAPNQHFASA-N |
| XLogP | 2.70 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-(1,2,5-trimethylpiperidin-4-ylidene)amino] 4-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-(1,2,5-trimethylpiperidin-4-ylidene)amino] 4-fluorobenzoate?
The IUPAC name of [(E)-(1,2,5-trimethylpiperidin-4-ylidene)amino] 4-fluorobenzoate (CID 6158230) is [(E)-(1,2,5-trimethylpiperidin-4-ylidene)amino] 4-fluorobenzoate.
What is the SMILES notation for [(E)-(1,2,5-trimethylpiperidin-4-ylidene)amino] 4-fluorobenzoate?
The canonical SMILES for [(E)-(1,2,5-trimethylpiperidin-4-ylidene)amino] 4-fluorobenzoate is CC1CN(C)C(C)C/C1=N\OC(=O)c1ccc(F)cc1.
What is the InChIKey of [(E)-(1,2,5-trimethylpiperidin-4-ylidene)amino] 4-fluorobenzoate?
The InChIKey is BBOGVVJGROGHRN-SAPNQHFASA-N. The full InChI is InChI=1S/C15H19FN2O2/c1-10-9-18(3)11(2)8-14(10)17-20-15(19)12-4-6-13(16)7-5-12/h4-7,10-11H,8-9H2,1-3H3/b17-14+.
What are the key properties of [(E)-(1,2,5-trimethylpiperidin-4-ylidene)amino] 4-fluorobenzoate?
[(E)-(1,2,5-trimethylpiperidin-4-ylidene)amino] 4-fluorobenzoate has a molecular weight of 278.33 g/mol, XLogP of 2.70, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-(1,2,5-trimethylpiperidin-4-ylidene)amino] 4-fluorobenzoate is sourced from PubChem (CID 6158230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).