About 3-(2,6-difluorophenyl)-4-pyridin-3-yl-1,2,4-oxadiazol-5-one
3-(2,6-difluorophenyl)-4-pyridin-3-yl-1,2,4-oxadiazol-5-one (PubChem CID 615858) has the molecular formula C13H7F2N3O2
and a molecular weight of 275.21 g/mol. Its IUPAC name is 3-(2,6-difluorophenyl)-4-pyridin-3-yl-1,2,4-oxadiazol-5-one.
Molecular Properties
| Compound Name | 3-(2,6-difluorophenyl)-4-pyridin-3-yl-1,2,4-oxadiazol-5-one |
| PubChem CID | 615858 |
| Molecular Formula | C13H7F2N3O2 |
| Molecular Weight | 275.21 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | 3-(2,6-difluorophenyl)-4-pyridin-3-yl-1,2,4-oxadiazol-5-one |
| SMILES | O=c1onc(-c2c(F)cccc2F)n1-c1cccnc1 |
| InChI | InChI=1S/C13H7F2N3O2/c14-9-4-1-5-10(15)11(9)12-17-20-13(19)18(12)8-3-2-6-16-7-8/h1-7H |
| InChIKey | LWKGPMWXTPCJOL-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.21 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(2,6-difluorophenyl)-4-pyridin-3-yl-1,2,4-oxadiazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,6-difluorophenyl)-4-pyridin-3-yl-1,2,4-oxadiazol-5-one?
The IUPAC name of 3-(2,6-difluorophenyl)-4-pyridin-3-yl-1,2,4-oxadiazol-5-one (CID 615858) is 3-(2,6-difluorophenyl)-4-pyridin-3-yl-1,2,4-oxadiazol-5-one.
What is the SMILES notation for 3-(2,6-difluorophenyl)-4-pyridin-3-yl-1,2,4-oxadiazol-5-one?
The canonical SMILES for 3-(2,6-difluorophenyl)-4-pyridin-3-yl-1,2,4-oxadiazol-5-one is O=c1onc(-c2c(F)cccc2F)n1-c1cccnc1.
What is the InChIKey of 3-(2,6-difluorophenyl)-4-pyridin-3-yl-1,2,4-oxadiazol-5-one?
The InChIKey is LWKGPMWXTPCJOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7F2N3O2/c14-9-4-1-5-10(15)11(9)12-17-20-13(19)18(12)8-3-2-6-16-7-8/h1-7H.
What are the key properties of 3-(2,6-difluorophenyl)-4-pyridin-3-yl-1,2,4-oxadiazol-5-one?
3-(2,6-difluorophenyl)-4-pyridin-3-yl-1,2,4-oxadiazol-5-one has a molecular weight of 275.21 g/mol, XLogP of 2.17, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,6-difluorophenyl)-4-pyridin-3-yl-1,2,4-oxadiazol-5-one is sourced from PubChem (CID 615858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).