C18H16N2O3 — CID 6159228
4-[(E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-oxoprop-1-enyl]-1,5-dimethylpyrrole-2-carbonitrile (PubChem CID 6159228) has the molecular formula C18H16N2O3 and a molecular weight of 308.34 g/mol. Its IUPAC name is 4-[(E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-oxoprop-1-enyl]-1,5-dimethylpyrrole-2-carbonitrile.
| Compound Name | 4-[(E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-oxoprop-1-enyl]-1,5-dimethylpyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 6159228 |
| Molecular Formula | C18H16N2O3 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 4-[(E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-oxoprop-1-enyl]-1,5-dimethylpyrrole-2-carbonitrile |
| SMILES | Cc1c(/C=C/C(=O)c2ccc3c(c2)OCCO3)cc(C#N)n1C |
| InChI | InChI=1S/C18H16N2O3/c1-12-13(9-15(11-19)20(12)2)3-5-16(21)14-4-6-17-18(10-14)23-8-7-22-17/h3-6,9-10H,7-8H2,1-2H3/b5-3+ |
| InChIKey | ABDHCVSZDXIHJS-HWKANZROSA-N |
| XLogP | 2.87 |
| TPSA | 64.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|