C28H29N3O5S2 — CID 6159649
dimethyl 5-[[(5Z)-3-cyclohexyl-5-(3-ethyl-1,3-benzothiazol-2-ylidene)-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzene-1,3-dicarboxylate (PubChem CID 6159649) has the molecular formula C28H29N3O5S2 and a molecular weight of 551.69 g/mol. Its IUPAC name is dimethyl 5-[[(5Z)-3-cyclohexyl-5-(3-ethyl-1,3-benzothiazol-2-ylidene)-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[(5Z)-3-cyclohexyl-5-(3-ethyl-1,3-benzothiazol-2-ylidene)-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 6159649 |
| Molecular Formula | C28H29N3O5S2 |
| Molecular Weight | 551.69 g/mol |
| Exact Mass | 551.15 |
| IUPAC Name | dimethyl 5-[[(5Z)-3-cyclohexyl-5-(3-ethyl-1,3-benzothiazol-2-ylidene)-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzene-1,3-dicarboxylate |
| SMILES | CCN1/C(=C2/S/C(=N\c3cc(C(=O)OC)cc(C(=O)OC)c3)N(C3CCCCC3)C2=O)Sc2ccccc21 |
| InChI | InChI=1S/C28H29N3O5S2/c1-4-30-21-12-8-9-13-22(21)37-25(30)23-24(32)31(20-10-6-5-7-11-20)28(38-23)29-19-15-17(26(33)35-2)14-18(16-19)27(34)36-3/h8-9,12-16,20H,4-7,10-11H2,1-3H3/b25-23-,29-28- |
| InChIKey | WEDCUSPWZNHTQY-WNIXFEBLSA-N |
| XLogP | 5.96 |
| TPSA | 88.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.69 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|