About [(E)-(3-methyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] 4-fluorobenzoate
[(E)-(3-methyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] 4-fluorobenzoate (PubChem CID 6160784) has the molecular formula C14H10FNO3
and a molecular weight of 259.24 g/mol. Its IUPAC name is [(E)-(3-methyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] 4-fluorobenzoate.
Molecular Properties
| Compound Name | [(E)-(3-methyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] 4-fluorobenzoate |
| PubChem CID | 6160784 |
| Molecular Formula | C14H10FNO3 |
| Molecular Weight | 259.24 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | [(E)-(3-methyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] 4-fluorobenzoate |
| SMILES | CC1=C/C(=N/OC(=O)c2ccc(F)cc2)C=CC1=O |
| InChI | InChI=1S/C14H10FNO3/c1-9-8-12(6-7-13(9)17)16-19-14(18)10-2-4-11(15)5-3-10/h2-8H,1H3/b16-12+ |
| InChIKey | FKDWKGVOYBSRKS-FOWTUZBSSA-N |
| XLogP | 2.42 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.24 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-(3-methyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] 4-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-(3-methyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] 4-fluorobenzoate?
The IUPAC name of [(E)-(3-methyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] 4-fluorobenzoate (CID 6160784) is [(E)-(3-methyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] 4-fluorobenzoate.
What is the SMILES notation for [(E)-(3-methyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] 4-fluorobenzoate?
The canonical SMILES for [(E)-(3-methyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] 4-fluorobenzoate is CC1=C/C(=N/OC(=O)c2ccc(F)cc2)C=CC1=O.
What is the InChIKey of [(E)-(3-methyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] 4-fluorobenzoate?
The InChIKey is FKDWKGVOYBSRKS-FOWTUZBSSA-N. The full InChI is InChI=1S/C14H10FNO3/c1-9-8-12(6-7-13(9)17)16-19-14(18)10-2-4-11(15)5-3-10/h2-8H,1H3/b16-12+.
What are the key properties of [(E)-(3-methyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] 4-fluorobenzoate?
[(E)-(3-methyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] 4-fluorobenzoate has a molecular weight of 259.24 g/mol, XLogP of 2.42, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-(3-methyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] 4-fluorobenzoate is sourced from PubChem (CID 6160784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).