About 6-methylbenzimidazolo[1,2-c]quinazoline
6-methylbenzimidazolo[1,2-c]quinazoline (PubChem CID 616273) has the molecular formula C15H11N3
and a molecular weight of 233.27 g/mol. Its IUPAC name is 6-methylbenzimidazolo[1,2-c]quinazoline.
Molecular Properties
| Compound Name | 6-methylbenzimidazolo[1,2-c]quinazoline |
| PubChem CID | 616273 |
| Molecular Formula | C15H11N3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 6-methylbenzimidazolo[1,2-c]quinazoline |
| SMILES | Cc1nc2ccccc2c2nc3ccccc3n12 |
| InChI | InChI=1S/C15H11N3/c1-10-16-12-7-3-2-6-11(12)15-17-13-8-4-5-9-14(13)18(10)15/h2-9H,1H3 |
| InChIKey | NQIDXSKSTZTFTA-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-methylbenzimidazolo[1,2-c]quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylbenzimidazolo[1,2-c]quinazoline?
The IUPAC name of 6-methylbenzimidazolo[1,2-c]quinazoline (CID 616273) is 6-methylbenzimidazolo[1,2-c]quinazoline.
What is the SMILES notation for 6-methylbenzimidazolo[1,2-c]quinazoline?
The canonical SMILES for 6-methylbenzimidazolo[1,2-c]quinazoline is Cc1nc2ccccc2c2nc3ccccc3n12.
What is the InChIKey of 6-methylbenzimidazolo[1,2-c]quinazoline?
The InChIKey is NQIDXSKSTZTFTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11N3/c1-10-16-12-7-3-2-6-11(12)15-17-13-8-4-5-9-14(13)18(10)15/h2-9H,1H3.
What are the key properties of 6-methylbenzimidazolo[1,2-c]quinazoline?
6-methylbenzimidazolo[1,2-c]quinazoline has a molecular weight of 233.27 g/mol, XLogP of 3.34, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylbenzimidazolo[1,2-c]quinazoline is sourced from PubChem (CID 616273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).