C29H31N6O3P — CID 6163027
4-[(4Z)-3-(2-nitrophenyl)imino-2-phenyl-4-(1,3,3-trimethylindol-2-ylidene)-1,2,3λ5-diazaphosphol-3-yl]morpholine (PubChem CID 6163027) has the molecular formula C29H31N6O3P and a molecular weight of 542.58 g/mol. Its IUPAC name is 4-[(4Z)-3-(2-nitrophenyl)imino-2-phenyl-4-(1,3,3-trimethylindol-2-ylidene)-1,2,3λ5-diazaphosphol-3-yl]morpholine.
| Compound Name | 4-[(4Z)-3-(2-nitrophenyl)imino-2-phenyl-4-(1,3,3-trimethylindol-2-ylidene)-1,2,3λ5-diazaphosphol-3-yl]morpholine |
|---|---|
| PubChem CID | 6163027 |
| Molecular Formula | C29H31N6O3P |
| Molecular Weight | 542.58 g/mol |
| Exact Mass | 542.22 |
| IUPAC Name | 4-[(4Z)-3-(2-nitrophenyl)imino-2-phenyl-4-(1,3,3-trimethylindol-2-ylidene)-1,2,3λ5-diazaphosphol-3-yl]morpholine |
| SMILES | CN1/C(=C2/C=NN(c3ccccc3)P2(=Nc2ccccc2[N+](=O)[O-])N2CCOCC2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C29H31N6O3P/c1-29(2)23-13-7-9-15-25(23)32(3)28(29)27-21-30-34(22-11-5-4-6-12-22)39(27,33-17-19-38-20-18-33)31-24-14-8-10-16-26(24)35(36)37/h4-16,21H,17-20H2,1-3H3/b28-27- |
| InChIKey | GZUHOVYJXSMIMA-DQSJHHFOSA-N |
| XLogP | 6.73 |
| TPSA | 86.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.58 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|