About (E)-2-(2-chloro-5-nitro-4-pyridinyl)-N,N-dimethylethenamine
(E)-2-(2-chloro-5-nitro-4-pyridinyl)-N,N-dimethylethenamine (PubChem CID 6163756) has the molecular formula C9H10ClN3O2
and a molecular weight of 227.65 g/mol. Its IUPAC name is (E)-2-(2-chloro-5-nitro-4-pyridinyl)-N,N-dimethylethenamine.
Molecular Properties
| Compound Name | (E)-2-(2-chloro-5-nitro-4-pyridinyl)-N,N-dimethylethenamine |
| PubChem CID | 6163756 |
| Molecular Formula | C9H10ClN3O2 |
| Molecular Weight | 227.65 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | (E)-2-(2-chloro-5-nitro-4-pyridinyl)-N,N-dimethylethenamine |
| SMILES | CN(C)/C=C/c1cc(Cl)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H10ClN3O2/c1-12(2)4-3-7-5-9(10)11-6-8(7)13(14)15/h3-6H,1-2H3/b4-3+ |
| InChIKey | ZKXSBZKRONWVMK-ONEGZZNKSA-N |
| XLogP | 2.18 |
| TPSA | 59.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.65 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-(2-chloro-5-nitro-4-pyridinyl)-N,N-dimethylethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-(2-chloro-5-nitro-4-pyridinyl)-N,N-dimethylethenamine?
The IUPAC name of (E)-2-(2-chloro-5-nitro-4-pyridinyl)-N,N-dimethylethenamine (CID 6163756) is (E)-2-(2-chloro-5-nitro-4-pyridinyl)-N,N-dimethylethenamine.
What is the SMILES notation for (E)-2-(2-chloro-5-nitro-4-pyridinyl)-N,N-dimethylethenamine?
The canonical SMILES for (E)-2-(2-chloro-5-nitro-4-pyridinyl)-N,N-dimethylethenamine is CN(C)/C=C/c1cc(Cl)ncc1[N+](=O)[O-].
What is the InChIKey of (E)-2-(2-chloro-5-nitro-4-pyridinyl)-N,N-dimethylethenamine?
The InChIKey is ZKXSBZKRONWVMK-ONEGZZNKSA-N. The full InChI is InChI=1S/C9H10ClN3O2/c1-12(2)4-3-7-5-9(10)11-6-8(7)13(14)15/h3-6H,1-2H3/b4-3+.
What are the key properties of (E)-2-(2-chloro-5-nitro-4-pyridinyl)-N,N-dimethylethenamine?
(E)-2-(2-chloro-5-nitro-4-pyridinyl)-N,N-dimethylethenamine has a molecular weight of 227.65 g/mol, XLogP of 2.18, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-(2-chloro-5-nitro-4-pyridinyl)-N,N-dimethylethenamine is sourced from PubChem (CID 6163756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).