About 6,11-dihydroquinoxalino[2,3-b]quinoxaline
6,11-dihydroquinoxalino[2,3-b]quinoxaline (PubChem CID 616479) has the molecular formula C14H10N4
and a molecular weight of 234.26 g/mol. Its IUPAC name is 6,11-dihydroquinoxalino[2,3-b]quinoxaline.
Molecular Properties
| Compound Name | 6,11-dihydroquinoxalino[2,3-b]quinoxaline |
| PubChem CID | 616479 |
| Molecular Formula | C14H10N4 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 6,11-dihydroquinoxalino[2,3-b]quinoxaline |
| SMILES | c1ccc2c(c1)Nc1nc3ccccc3nc1N2 |
| InChI | InChI=1S/C14H10N4/c1-2-6-10-9(5-1)15-13-14(16-10)18-12-8-4-3-7-11(12)17-13/h1-8H,(H,15,17)(H,16,18) |
| InChIKey | WGKYYZDYHYOKQV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6,11-dihydroquinoxalino[2,3-b]quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,11-dihydroquinoxalino[2,3-b]quinoxaline?
The IUPAC name of 6,11-dihydroquinoxalino[2,3-b]quinoxaline (CID 616479) is 6,11-dihydroquinoxalino[2,3-b]quinoxaline.
What is the SMILES notation for 6,11-dihydroquinoxalino[2,3-b]quinoxaline?
The canonical SMILES for 6,11-dihydroquinoxalino[2,3-b]quinoxaline is c1ccc2c(c1)Nc1nc3ccccc3nc1N2.
What is the InChIKey of 6,11-dihydroquinoxalino[2,3-b]quinoxaline?
The InChIKey is WGKYYZDYHYOKQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N4/c1-2-6-10-9(5-1)15-13-14(16-10)18-12-8-4-3-7-11(12)17-13/h1-8H,(H,15,17)(H,16,18).
What are the key properties of 6,11-dihydroquinoxalino[2,3-b]quinoxaline?
6,11-dihydroquinoxalino[2,3-b]quinoxaline has a molecular weight of 234.26 g/mol, XLogP of 3.43, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6,11-dihydroquinoxalino[2,3-b]quinoxaline is sourced from PubChem (CID 616479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).