C42H23N3O6 — CID 6165091
1-[(5-amino-9,10-dioxoanthracen-1-yl)amino]-4-[(9,10-dioxoanthracen-1-yl)amino]anthracene-9,10-dione (PubChem CID 6165091) has the molecular formula C42H23N3O6 and a molecular weight of 665.66 g/mol. Its IUPAC name is 1-[(5-amino-9,10-dioxoanthracen-1-yl)amino]-4-[(9,10-dioxoanthracen-1-yl)amino]anthracene-9,10-dione.
| Compound Name | 1-[(5-amino-9,10-dioxoanthracen-1-yl)amino]-4-[(9,10-dioxoanthracen-1-yl)amino]anthracene-9,10-dione |
|---|---|
| PubChem CID | 6165091 |
| Molecular Formula | C42H23N3O6 |
| Molecular Weight | 665.66 g/mol |
| Exact Mass | 665.16 |
| IUPAC Name | 1-[(5-amino-9,10-dioxoanthracen-1-yl)amino]-4-[(9,10-dioxoanthracen-1-yl)amino]anthracene-9,10-dione |
| SMILES | Nc1cccc2c1C(=O)c1cccc(Nc3ccc(Nc4cccc5c4C(=O)c4ccccc4C5=O)c4c3C(=O)c3ccccc3C4=O)c1C2=O |
| InChI | InChI=1S/C42H23N3O6/c43-27-15-5-12-24-32(27)41(50)26-14-7-17-29(34(26)42(24)51)45-31-19-18-30(35-36(31)40(49)23-11-4-3-10-22(23)39(35)48)44-28-16-6-13-25-33(28)38(47)21-9-2-1-8-20(21)37(25)46/h1-19,44-45H,43H2 |
| InChIKey | KFLHQYQBEPRHQR-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 152.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.66 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|