C27H26N4O2 — CID 6165907
3-[(3,5-dimethylpyrazol-1-yl)methyl]-N-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]benzamide (PubChem CID 6165907) has the molecular formula C27H26N4O2 and a molecular weight of 438.53 g/mol. Its IUPAC name is 3-[(3,5-dimethylpyrazol-1-yl)methyl]-N-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]benzamide.
| Compound Name | 3-[(3,5-dimethylpyrazol-1-yl)methyl]-N-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 6165907 |
| Molecular Formula | C27H26N4O2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | 3-[(3,5-dimethylpyrazol-1-yl)methyl]-N-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]benzamide |
| SMILES | Cc1cc(C)n(Cc2cccc(C(=O)N/N=C\c3ccccc3OCc3ccccc3)c2)n1 |
| InChI | InChI=1S/C27H26N4O2/c1-20-15-21(2)31(30-20)18-23-11-8-13-24(16-23)27(32)29-28-17-25-12-6-7-14-26(25)33-19-22-9-4-3-5-10-22/h3-17H,18-19H2,1-2H3,(H,29,32)/b28-17- |
| InChIKey | BONCLRYKDHSDJI-QRQIAZFYSA-N |
| XLogP | 4.89 |
| TPSA | 68.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|