About (2E,4Z)-8-methyl-2,4-bis(1H-pyrrol-2-ylmethylidene)-8-azabicyclo[3.2.1]octan-3-one
(2E,4Z)-8-methyl-2,4-bis(1H-pyrrol-2-ylmethylidene)-8-azabicyclo[3.2.1]octan-3-one (PubChem CID 6166701) has the molecular formula C18H19N3O
and a molecular weight of 293.37 g/mol. Its IUPAC name is (2E,4Z)-8-methyl-2,4-bis(1H-pyrrol-2-ylmethylidene)-8-azabicyclo[3.2.1]octan-3-one.
Molecular Properties
| Compound Name | (2E,4Z)-8-methyl-2,4-bis(1H-pyrrol-2-ylmethylidene)-8-azabicyclo[3.2.1]octan-3-one |
| PubChem CID | 6166701 |
| Molecular Formula | C18H19N3O |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | (2E,4Z)-8-methyl-2,4-bis(1H-pyrrol-2-ylmethylidene)-8-azabicyclo[3.2.1]octan-3-one |
| SMILES | CN1C2CCC1/C(=C\c1ccc[nH]1)C(=O)/C2=C\c1ccc[nH]1 |
| InChI | InChI=1S/C18H19N3O/c1-21-16-6-7-17(21)15(11-13-5-3-9-20-13)18(22)14(16)10-12-4-2-8-19-12/h2-5,8-11,16-17,19-20H,6-7H2,1H3/b14-10-,15-11+ |
| InChIKey | UTIVJFPJRPAEBG-YCRUPXPOSA-N |
| XLogP | 2.86 |
| TPSA | 51.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2E,4Z)-8-methyl-2,4-bis(1H-pyrrol-2-ylmethylidene)-8-azabicyclo[3.2.1]octan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4Z)-8-methyl-2,4-bis(1H-pyrrol-2-ylmethylidene)-8-azabicyclo[3.2.1]octan-3-one?
The IUPAC name of (2E,4Z)-8-methyl-2,4-bis(1H-pyrrol-2-ylmethylidene)-8-azabicyclo[3.2.1]octan-3-one (CID 6166701) is (2E,4Z)-8-methyl-2,4-bis(1H-pyrrol-2-ylmethylidene)-8-azabicyclo[3.2.1]octan-3-one.
What is the SMILES notation for (2E,4Z)-8-methyl-2,4-bis(1H-pyrrol-2-ylmethylidene)-8-azabicyclo[3.2.1]octan-3-one?
The canonical SMILES for (2E,4Z)-8-methyl-2,4-bis(1H-pyrrol-2-ylmethylidene)-8-azabicyclo[3.2.1]octan-3-one is CN1C2CCC1/C(=C\c1ccc[nH]1)C(=O)/C2=C\c1ccc[nH]1.
What is the InChIKey of (2E,4Z)-8-methyl-2,4-bis(1H-pyrrol-2-ylmethylidene)-8-azabicyclo[3.2.1]octan-3-one?
The InChIKey is UTIVJFPJRPAEBG-YCRUPXPOSA-N. The full InChI is InChI=1S/C18H19N3O/c1-21-16-6-7-17(21)15(11-13-5-3-9-20-13)18(22)14(16)10-12-4-2-8-19-12/h2-5,8-11,16-17,19-20H,6-7H2,1H3/b14-10-,15-11+.
What are the key properties of (2E,4Z)-8-methyl-2,4-bis(1H-pyrrol-2-ylmethylidene)-8-azabicyclo[3.2.1]octan-3-one?
(2E,4Z)-8-methyl-2,4-bis(1H-pyrrol-2-ylmethylidene)-8-azabicyclo[3.2.1]octan-3-one has a molecular weight of 293.37 g/mol, XLogP of 2.86, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4Z)-8-methyl-2,4-bis(1H-pyrrol-2-ylmethylidene)-8-azabicyclo[3.2.1]octan-3-one is sourced from PubChem (CID 6166701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).