About 5-methyl-2,3-diphenyl-3,4-dihydropyrazole
5-methyl-2,3-diphenyl-3,4-dihydropyrazole (PubChem CID 616784) has the molecular formula C16H16N2
and a molecular weight of 236.32 g/mol. Its IUPAC name is 5-methyl-2,3-diphenyl-3,4-dihydropyrazole.
Molecular Properties
| Compound Name | 5-methyl-2,3-diphenyl-3,4-dihydropyrazole |
| PubChem CID | 616784 |
| Molecular Formula | C16H16N2 |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 5-methyl-2,3-diphenyl-3,4-dihydropyrazole |
| SMILES | CC1=NN(c2ccccc2)C(c2ccccc2)C1 |
| InChI | InChI=1S/C16H16N2/c1-13-12-16(14-8-4-2-5-9-14)18(17-13)15-10-6-3-7-11-15/h2-11,16H,12H2,1H3 |
| InChIKey | FZTOIOYDPXSQDM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methyl-2,3-diphenyl-3,4-dihydropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2,3-diphenyl-3,4-dihydropyrazole?
The IUPAC name of 5-methyl-2,3-diphenyl-3,4-dihydropyrazole (CID 616784) is 5-methyl-2,3-diphenyl-3,4-dihydropyrazole.
What is the SMILES notation for 5-methyl-2,3-diphenyl-3,4-dihydropyrazole?
The canonical SMILES for 5-methyl-2,3-diphenyl-3,4-dihydropyrazole is CC1=NN(c2ccccc2)C(c2ccccc2)C1.
What is the InChIKey of 5-methyl-2,3-diphenyl-3,4-dihydropyrazole?
The InChIKey is FZTOIOYDPXSQDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2/c1-13-12-16(14-8-4-2-5-9-14)18(17-13)15-10-6-3-7-11-15/h2-11,16H,12H2,1H3.
What are the key properties of 5-methyl-2,3-diphenyl-3,4-dihydropyrazole?
5-methyl-2,3-diphenyl-3,4-dihydropyrazole has a molecular weight of 236.32 g/mol, XLogP of 4.01, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2,3-diphenyl-3,4-dihydropyrazole is sourced from PubChem (CID 616784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).