C16H18BNO — CID 616862
3,4-dimethyl-2,5-diphenyl-1,3,2-oxazaborolidine (PubChem CID 616862) has the molecular formula C16H18BNO and a molecular weight of 251.14 g/mol. Its IUPAC name is 3,4-dimethyl-2,5-diphenyl-1,3,2-oxazaborolidine.
| Compound Name | 3,4-dimethyl-2,5-diphenyl-1,3,2-oxazaborolidine |
|---|---|
| PubChem CID | 616862 |
| Molecular Formula | C16H18BNO |
| Molecular Weight | 251.14 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 3,4-dimethyl-2,5-diphenyl-1,3,2-oxazaborolidine |
| SMILES | CC1C(c2ccccc2)OB(c2ccccc2)N1C |
| InChI | InChI=1S/C16H18BNO/c1-13-16(14-9-5-3-6-10-14)19-17(18(13)2)15-11-7-4-8-12-15/h3-13,16H,1-2H3 |
| InChIKey | RHEOVNWEAAUANC-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.14 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|