C31H25Cl2N3O5S2 — CID 6168747
(4E)-1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-5-(3-ethoxy-4-prop-2-enoxyphenyl)-4-[hydroxy(phenyl)methylidene]pyrrolidine-2,3-dione (PubChem CID 6168747) has the molecular formula C31H25Cl2N3O5S2 and a molecular weight of 654.60 g/mol. Its IUPAC name is (4E)-1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-5-(3-ethoxy-4-prop-2-enoxyphenyl)-4-[hydroxy(phenyl)methylidene]pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-5-(3-ethoxy-4-prop-2-enoxyphenyl)-4-[hydroxy(phenyl)methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6168747 |
| Molecular Formula | C31H25Cl2N3O5S2 |
| Molecular Weight | 654.60 g/mol |
| Exact Mass | 653.06 |
| IUPAC Name | (4E)-1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-5-(3-ethoxy-4-prop-2-enoxyphenyl)-4-[hydroxy(phenyl)methylidene]pyrrolidine-2,3-dione |
| SMILES | C=CCOc1ccc(C2/C(=C(\O)c3ccccc3)C(=O)C(=O)N2c2nnc(SCc3ccc(Cl)cc3Cl)s2)cc1OCC |
| InChI | InChI=1S/C31H25Cl2N3O5S2/c1-3-14-41-23-13-11-19(15-24(23)40-4-2)26-25(27(37)18-8-6-5-7-9-18)28(38)29(39)36(26)30-34-35-31(43-30)42-17-20-10-12-21(32)16-22(20)33/h3,5-13,15-16,26,37H,1,4,14,17H2,2H3/b27-25+ |
| InChIKey | PEOCWTAOTMFBFV-IMVLJIQESA-N |
| XLogP | 7.73 |
| TPSA | 101.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.60 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|