About 3-thiophen-2-yl-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol
3-thiophen-2-yl-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol (PubChem CID 616925) has the molecular formula C8H6F3NO2S
and a molecular weight of 237.20 g/mol. Its IUPAC name is 3-thiophen-2-yl-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol.
Molecular Properties
| Compound Name | 3-thiophen-2-yl-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol |
| PubChem CID | 616925 |
| Molecular Formula | C8H6F3NO2S |
| Molecular Weight | 237.20 g/mol |
| Exact Mass | 237.01 |
| IUPAC Name | 3-thiophen-2-yl-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol |
| SMILES | OC1(C(F)(F)F)CC(c2cccs2)=NO1 |
| InChI | InChI=1S/C8H6F3NO2S/c9-8(10,11)7(13)4-5(12-14-7)6-2-1-3-15-6/h1-3,13H,4H2 |
| InChIKey | WJPBGIHUZWQXOV-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.20 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-thiophen-2-yl-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-thiophen-2-yl-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol?
The IUPAC name of 3-thiophen-2-yl-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol (CID 616925) is 3-thiophen-2-yl-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol.
What is the SMILES notation for 3-thiophen-2-yl-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol?
The canonical SMILES for 3-thiophen-2-yl-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol is OC1(C(F)(F)F)CC(c2cccs2)=NO1.
What is the InChIKey of 3-thiophen-2-yl-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol?
The InChIKey is WJPBGIHUZWQXOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6F3NO2S/c9-8(10,11)7(13)4-5(12-14-7)6-2-1-3-15-6/h1-3,13H,4H2.
What are the key properties of 3-thiophen-2-yl-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol?
3-thiophen-2-yl-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol has a molecular weight of 237.20 g/mol, XLogP of 2.12, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-thiophen-2-yl-5-(trifluoromethyl)-4H-1,2-oxazol-5-ol is sourced from PubChem (CID 616925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).