C14H24N2O5S2 — CID 616945
1,3-dioxo-2-[4-(2-sulfosulfanylethylamino)butyl]-3a,4,5,6,7,7a-hexahydroisoindole (PubChem CID 616945) has the molecular formula C14H24N2O5S2 and a molecular weight of 364.49 g/mol. Its IUPAC name is 1,3-dioxo-2-[4-(2-sulfosulfanylethylamino)butyl]-3a,4,5,6,7,7a-hexahydroisoindole.
| Compound Name | 1,3-dioxo-2-[4-(2-sulfosulfanylethylamino)butyl]-3a,4,5,6,7,7a-hexahydroisoindole |
|---|---|
| PubChem CID | 616945 |
| Molecular Formula | C14H24N2O5S2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 1,3-dioxo-2-[4-(2-sulfosulfanylethylamino)butyl]-3a,4,5,6,7,7a-hexahydroisoindole |
| SMILES | O=C1C2CCCCC2C(=O)N1CCCCNCCSS(=O)(=O)O |
| InChI | InChI=1S/C14H24N2O5S2/c17-13-11-5-1-2-6-12(11)14(18)16(13)9-4-3-7-15-8-10-22-23(19,20)21/h11-12,15H,1-10H2,(H,19,20,21) |
| InChIKey | VRDNKCZMOIYADL-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|