C30H30ClNO5 — CID 6169491
(4E)-4-[(4-chlorophenyl)-hydroxymethylidene]-5-(3-ethoxy-4-propoxyphenyl)-1-(2-phenylethyl)pyrrolidine-2,3-dione (PubChem CID 6169491) has the molecular formula C30H30ClNO5 and a molecular weight of 520.03 g/mol. Its IUPAC name is (4E)-4-[(4-chlorophenyl)-hydroxymethylidene]-5-(3-ethoxy-4-propoxyphenyl)-1-(2-phenylethyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(4-chlorophenyl)-hydroxymethylidene]-5-(3-ethoxy-4-propoxyphenyl)-1-(2-phenylethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6169491 |
| Molecular Formula | C30H30ClNO5 |
| Molecular Weight | 520.03 g/mol |
| Exact Mass | 519.18 |
| IUPAC Name | (4E)-4-[(4-chlorophenyl)-hydroxymethylidene]-5-(3-ethoxy-4-propoxyphenyl)-1-(2-phenylethyl)pyrrolidine-2,3-dione |
| SMILES | CCCOc1ccc(C2/C(=C(\O)c3ccc(Cl)cc3)C(=O)C(=O)N2CCc2ccccc2)cc1OCC |
| InChI | InChI=1S/C30H30ClNO5/c1-3-18-37-24-15-12-22(19-25(24)36-4-2)27-26(28(33)21-10-13-23(31)14-11-21)29(34)30(35)32(27)17-16-20-8-6-5-7-9-20/h5-15,19,27,33H,3-4,16-18H2,1-2H3/b28-26+ |
| InChIKey | LHOXWNCGIWQEKM-BYCLXTJYSA-N |
| XLogP | 6.19 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.03 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|