About 4-methyldithiolo[3,4-b]indole-1-thione
4-methyldithiolo[3,4-b]indole-1-thione (PubChem CID 617010) has the molecular formula C10H7NS3
and a molecular weight of 237.37 g/mol. Its IUPAC name is 4-methyldithiolo[3,4-b]indole-1-thione.
Molecular Properties
| Compound Name | 4-methyldithiolo[3,4-b]indole-1-thione |
| PubChem CID | 617010 |
| Molecular Formula | C10H7NS3 |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 236.97 |
| IUPAC Name | 4-methyldithiolo[3,4-b]indole-1-thione |
| SMILES | Cn1c2ccccc2c2c(=S)ssc21 |
| InChI | InChI=1S/C10H7NS3/c1-11-7-5-3-2-4-6(7)8-9(11)13-14-10(8)12/h2-5H,1H3 |
| InChIKey | GQWJYFCHDWMSTI-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-methyldithiolo[3,4-b]indole-1-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyldithiolo[3,4-b]indole-1-thione?
The IUPAC name of 4-methyldithiolo[3,4-b]indole-1-thione (CID 617010) is 4-methyldithiolo[3,4-b]indole-1-thione.
What is the SMILES notation for 4-methyldithiolo[3,4-b]indole-1-thione?
The canonical SMILES for 4-methyldithiolo[3,4-b]indole-1-thione is Cn1c2ccccc2c2c(=S)ssc21.
What is the InChIKey of 4-methyldithiolo[3,4-b]indole-1-thione?
The InChIKey is GQWJYFCHDWMSTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NS3/c1-11-7-5-3-2-4-6(7)8-9(11)13-14-10(8)12/h2-5H,1H3.
What are the key properties of 4-methyldithiolo[3,4-b]indole-1-thione?
4-methyldithiolo[3,4-b]indole-1-thione has a molecular weight of 237.37 g/mol, XLogP of 4.18, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyldithiolo[3,4-b]indole-1-thione is sourced from PubChem (CID 617010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).