C22H23NO6 — CID 6170298
(4E)-4-[hydroxy-(4-methoxyphenyl)methylidene]-5-(5-methylfuran-2-yl)-1-(oxolan-2-ylmethyl)pyrrolidine-2,3-dione (PubChem CID 6170298) has the molecular formula C22H23NO6 and a molecular weight of 397.43 g/mol. Its IUPAC name is (4E)-4-[hydroxy-(4-methoxyphenyl)methylidene]-5-(5-methylfuran-2-yl)-1-(oxolan-2-ylmethyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[hydroxy-(4-methoxyphenyl)methylidene]-5-(5-methylfuran-2-yl)-1-(oxolan-2-ylmethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6170298 |
| Molecular Formula | C22H23NO6 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | (4E)-4-[hydroxy-(4-methoxyphenyl)methylidene]-5-(5-methylfuran-2-yl)-1-(oxolan-2-ylmethyl)pyrrolidine-2,3-dione |
| SMILES | COc1ccc(/C(O)=C2\C(=O)C(=O)N(CC3CCCO3)C2c2ccc(C)o2)cc1 |
| InChI | InChI=1S/C22H23NO6/c1-13-5-10-17(29-13)19-18(20(24)14-6-8-15(27-2)9-7-14)21(25)22(26)23(19)12-16-4-3-11-28-16/h5-10,16,19,24H,3-4,11-12H2,1-2H3/b20-18+ |
| InChIKey | SKLZOSOJAMOWNQ-CZIZESTLSA-N |
| XLogP | 3.20 |
| TPSA | 89.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|