C20H38N2O2 — CID 617114
1-N,1-N,2-N,2-N-tetrapropylcyclohexane-1,2-dicarboxamide (PubChem CID 617114) has the molecular formula C20H38N2O2 and a molecular weight of 338.54 g/mol. Its IUPAC name is 1-N,1-N,2-N,2-N-tetrapropylcyclohexane-1,2-dicarboxamide.
| Compound Name | 1-N,1-N,2-N,2-N-tetrapropylcyclohexane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 617114 |
| Molecular Formula | C20H38N2O2 |
| Molecular Weight | 338.54 g/mol |
| Exact Mass | 338.29 |
| IUPAC Name | 1-N,1-N,2-N,2-N-tetrapropylcyclohexane-1,2-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)C1CCCCC1C(=O)N(CCC)CCC |
| InChI | InChI=1S/C20H38N2O2/c1-5-13-21(14-6-2)19(23)17-11-9-10-12-18(17)20(24)22(15-7-3)16-8-4/h17-18H,5-16H2,1-4H3 |
| InChIKey | VCIJVNROCIWRDH-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.54 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |