C30H32FNO5 — CID 6171154
(4E)-5-(3,5-ditert-butyl-4-hydroxyphenyl)-4-[(4-fluorophenyl)-hydroxymethylidene]-1-(furan-2-ylmethyl)pyrrolidine-2,3-dione (PubChem CID 6171154) has the molecular formula C30H32FNO5 and a molecular weight of 505.59 g/mol. Its IUPAC name is (4E)-5-(3,5-ditert-butyl-4-hydroxyphenyl)-4-[(4-fluorophenyl)-hydroxymethylidene]-1-(furan-2-ylmethyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-5-(3,5-ditert-butyl-4-hydroxyphenyl)-4-[(4-fluorophenyl)-hydroxymethylidene]-1-(furan-2-ylmethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6171154 |
| Molecular Formula | C30H32FNO5 |
| Molecular Weight | 505.59 g/mol |
| Exact Mass | 505.23 |
| IUPAC Name | (4E)-5-(3,5-ditert-butyl-4-hydroxyphenyl)-4-[(4-fluorophenyl)-hydroxymethylidene]-1-(furan-2-ylmethyl)pyrrolidine-2,3-dione |
| SMILES | CC(C)(C)c1cc(C2/C(=C(\O)c3ccc(F)cc3)C(=O)C(=O)N2Cc2ccco2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C30H32FNO5/c1-29(2,3)21-14-18(15-22(26(21)34)30(4,5)6)24-23(25(33)17-9-11-19(31)12-10-17)27(35)28(36)32(24)16-20-8-7-13-37-20/h7-15,24,33-34H,16H2,1-6H3/b25-23+ |
| InChIKey | UZKYGYWGBUUJSP-WJTDDFOZSA-N |
| XLogP | 6.34 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.59 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|