C32H30FN3O5S2 — CID 6171364
(4E)-5-(3-ethoxy-4-propoxyphenyl)-4-[(4-fluorophenyl)-hydroxymethylidene]-1-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]pyrrolidine-2,3-dione (PubChem CID 6171364) has the molecular formula C32H30FN3O5S2 and a molecular weight of 619.74 g/mol. Its IUPAC name is (4E)-5-(3-ethoxy-4-propoxyphenyl)-4-[(4-fluorophenyl)-hydroxymethylidene]-1-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]pyrrolidine-2,3-dione.
| Compound Name | (4E)-5-(3-ethoxy-4-propoxyphenyl)-4-[(4-fluorophenyl)-hydroxymethylidene]-1-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6171364 |
| Molecular Formula | C32H30FN3O5S2 |
| Molecular Weight | 619.74 g/mol |
| Exact Mass | 619.16 |
| IUPAC Name | (4E)-5-(3-ethoxy-4-propoxyphenyl)-4-[(4-fluorophenyl)-hydroxymethylidene]-1-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]pyrrolidine-2,3-dione |
| SMILES | CCCOc1ccc(C2/C(=C(\O)c3ccc(F)cc3)C(=O)C(=O)N2c2nnc(SCc3ccc(C)cc3)s2)cc1OCC |
| InChI | InChI=1S/C32H30FN3O5S2/c1-4-16-41-24-15-12-22(17-25(24)40-5-2)27-26(28(37)21-10-13-23(33)14-11-21)29(38)30(39)36(27)31-34-35-32(43-31)42-18-20-8-6-19(3)7-9-20/h6-15,17,27,37H,4-5,16,18H2,1-3H3/b28-26+ |
| InChIKey | QOEKGIZLQDLKQJ-BYCLXTJYSA-N |
| XLogP | 7.09 |
| TPSA | 101.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.74 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|