About 3,6-dimethoxyphenanthrene
3,6-dimethoxyphenanthrene (PubChem CID 617168) has the molecular formula C16H14O2
and a molecular weight of 238.29 g/mol. Its IUPAC name is 3,6-dimethoxyphenanthrene.
Molecular Properties
| Compound Name | 3,6-dimethoxyphenanthrene |
| PubChem CID | 617168 |
| Molecular Formula | C16H14O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 3,6-dimethoxyphenanthrene |
| SMILES | COc1ccc2ccc3ccc(OC)cc3c2c1 |
| InChI | InChI=1S/C16H14O2/c1-17-13-7-5-11-3-4-12-6-8-14(18-2)10-16(12)15(11)9-13/h3-10H,1-2H3 |
| InChIKey | FSOLYWGGLXQAMC-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 3,6-dimethoxyphenanthrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dimethoxyphenanthrene?
The IUPAC name of 3,6-dimethoxyphenanthrene (CID 617168) is 3,6-dimethoxyphenanthrene.
What is the SMILES notation for 3,6-dimethoxyphenanthrene?
The canonical SMILES for 3,6-dimethoxyphenanthrene is COc1ccc2ccc3ccc(OC)cc3c2c1.
What is the InChIKey of 3,6-dimethoxyphenanthrene?
The InChIKey is FSOLYWGGLXQAMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O2/c1-17-13-7-5-11-3-4-12-6-8-14(18-2)10-16(12)15(11)9-13/h3-10H,1-2H3.
What are the key properties of 3,6-dimethoxyphenanthrene?
3,6-dimethoxyphenanthrene has a molecular weight of 238.29 g/mol, XLogP of 4.01, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dimethoxyphenanthrene is sourced from PubChem (CID 617168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).