C11H14N2O2S — CID 617191
2-morpholin-4-yl-5,6-dihydro-4H-1,3-benzothiazol-7-one (PubChem CID 617191) has the molecular formula C11H14N2O2S and a molecular weight of 238.31 g/mol. Its IUPAC name is 2-morpholin-4-yl-5,6-dihydro-4H-1,3-benzothiazol-7-one.
| Compound Name | 2-morpholin-4-yl-5,6-dihydro-4H-1,3-benzothiazol-7-one |
|---|---|
| PubChem CID | 617191 |
| Molecular Formula | C11H14N2O2S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 2-morpholin-4-yl-5,6-dihydro-4H-1,3-benzothiazol-7-one |
| SMILES | O=C1CCCc2nc(N3CCOCC3)sc21 |
| InChI | InChI=1S/C11H14N2O2S/c14-9-3-1-2-8-10(9)16-11(12-8)13-4-6-15-7-5-13/h1-7H2 |
| InChIKey | KMKJCACZZADDPZ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |