C9H12FIN2O5 — CID 617215
1-[(4-fluoro-1,3-dihydroxybutan-2-yl)oxymethyl]-5-iodopyrimidine-2,4-dione (PubChem CID 617215) has the molecular formula C9H12FIN2O5 and a molecular weight of 374.11 g/mol. Its IUPAC name is 1-[(4-fluoro-1,3-dihydroxybutan-2-yl)oxymethyl]-5-iodopyrimidine-2,4-dione.
| Compound Name | 1-[(4-fluoro-1,3-dihydroxybutan-2-yl)oxymethyl]-5-iodopyrimidine-2,4-dione |
|---|---|
| PubChem CID | 617215 |
| Molecular Formula | C9H12FIN2O5 |
| Molecular Weight | 374.11 g/mol |
| Exact Mass | 373.98 |
| IUPAC Name | 1-[(4-fluoro-1,3-dihydroxybutan-2-yl)oxymethyl]-5-iodopyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(COC(CO)C(O)CF)cc1I |
| InChI | InChI=1S/C9H12FIN2O5/c10-1-6(15)7(3-14)18-4-13-2-5(11)8(16)12-9(13)17/h2,6-7,14-15H,1,3-4H2,(H,12,16,17) |
| InChIKey | FUYVOHIGXOOBHX-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.11 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|