About 1,3,5-trichloro-2-methoxy-4,6-dimethylbenzene
1,3,5-trichloro-2-methoxy-4,6-dimethylbenzene (PubChem CID 617275) has the molecular formula C9H9Cl3O
and a molecular weight of 239.53 g/mol. Its IUPAC name is 1,3,5-trichloro-2-methoxy-4,6-dimethylbenzene.
Molecular Properties
| Compound Name | 1,3,5-trichloro-2-methoxy-4,6-dimethylbenzene |
| PubChem CID | 617275 |
| Molecular Formula | C9H9Cl3O |
| Molecular Weight | 239.53 g/mol |
| Exact Mass | 237.97 |
| IUPAC Name | 1,3,5-trichloro-2-methoxy-4,6-dimethylbenzene |
| SMILES | COc1c(Cl)c(C)c(Cl)c(C)c1Cl |
| InChI | InChI=1S/C9H9Cl3O/c1-4-6(10)5(2)8(12)9(13-3)7(4)11/h1-3H3 |
| InChIKey | DMZXKTABWAXCIT-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.53 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,3,5-trichloro-2-methoxy-4,6-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,5-trichloro-2-methoxy-4,6-dimethylbenzene?
The IUPAC name of 1,3,5-trichloro-2-methoxy-4,6-dimethylbenzene (CID 617275) is 1,3,5-trichloro-2-methoxy-4,6-dimethylbenzene.
What is the SMILES notation for 1,3,5-trichloro-2-methoxy-4,6-dimethylbenzene?
The canonical SMILES for 1,3,5-trichloro-2-methoxy-4,6-dimethylbenzene is COc1c(Cl)c(C)c(Cl)c(C)c1Cl.
What is the InChIKey of 1,3,5-trichloro-2-methoxy-4,6-dimethylbenzene?
The InChIKey is DMZXKTABWAXCIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9Cl3O/c1-4-6(10)5(2)8(12)9(13-3)7(4)11/h1-3H3.
What are the key properties of 1,3,5-trichloro-2-methoxy-4,6-dimethylbenzene?
1,3,5-trichloro-2-methoxy-4,6-dimethylbenzene has a molecular weight of 239.53 g/mol, XLogP of 4.27, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,5-trichloro-2-methoxy-4,6-dimethylbenzene is sourced from PubChem (CID 617275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).