About (NE)-N-(3-benzyl-2,6-diphenylpiperidin-4-ylidene)hydroxylamine
(NE)-N-(3-benzyl-2,6-diphenylpiperidin-4-ylidene)hydroxylamine (PubChem CID 6173153) has the molecular formula C24H24N2O
and a molecular weight of 356.47 g/mol. Its IUPAC name is (NE)-N-(3-benzyl-2,6-diphenylpiperidin-4-ylidene)hydroxylamine.
Molecular Properties
| Compound Name | (NE)-N-(3-benzyl-2,6-diphenylpiperidin-4-ylidene)hydroxylamine |
| PubChem CID | 6173153 |
| Molecular Formula | C24H24N2O |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | (NE)-N-(3-benzyl-2,6-diphenylpiperidin-4-ylidene)hydroxylamine |
| SMILES | O/N=C1\CC(c2ccccc2)NC(c2ccccc2)C1Cc1ccccc1 |
| InChI | InChI=1S/C24H24N2O/c27-26-23-17-22(19-12-6-2-7-13-19)25-24(20-14-8-3-9-15-20)21(23)16-18-10-4-1-5-11-18/h1-15,21-22,24-25,27H,16-17H2/b26-23+ |
| InChIKey | ODMJIIJUJAYBCI-WNAAXNPUSA-N |
| XLogP | 5.15 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (NE)-N-(3-benzyl-2,6-diphenylpiperidin-4-ylidene)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NE)-N-(3-benzyl-2,6-diphenylpiperidin-4-ylidene)hydroxylamine?
The IUPAC name of (NE)-N-(3-benzyl-2,6-diphenylpiperidin-4-ylidene)hydroxylamine (CID 6173153) is (NE)-N-(3-benzyl-2,6-diphenylpiperidin-4-ylidene)hydroxylamine.
What is the SMILES notation for (NE)-N-(3-benzyl-2,6-diphenylpiperidin-4-ylidene)hydroxylamine?
The canonical SMILES for (NE)-N-(3-benzyl-2,6-diphenylpiperidin-4-ylidene)hydroxylamine is O/N=C1\CC(c2ccccc2)NC(c2ccccc2)C1Cc1ccccc1.
What is the InChIKey of (NE)-N-(3-benzyl-2,6-diphenylpiperidin-4-ylidene)hydroxylamine?
The InChIKey is ODMJIIJUJAYBCI-WNAAXNPUSA-N. The full InChI is InChI=1S/C24H24N2O/c27-26-23-17-22(19-12-6-2-7-13-19)25-24(20-14-8-3-9-15-20)21(23)16-18-10-4-1-5-11-18/h1-15,21-22,24-25,27H,16-17H2/b26-23+.
What are the key properties of (NE)-N-(3-benzyl-2,6-diphenylpiperidin-4-ylidene)hydroxylamine?
(NE)-N-(3-benzyl-2,6-diphenylpiperidin-4-ylidene)hydroxylamine has a molecular weight of 356.47 g/mol, XLogP of 5.15, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (NE)-N-(3-benzyl-2,6-diphenylpiperidin-4-ylidene)hydroxylamine is sourced from PubChem (CID 6173153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).