About 3-(2,4-dinitroanilino)benzoic acid
3-(2,4-dinitroanilino)benzoic acid (PubChem CID 617499) has the molecular formula C13H9N3O6
and a molecular weight of 303.23 g/mol. Its IUPAC name is 3-(2,4-dinitroanilino)benzoic acid.
Molecular Properties
| Compound Name | 3-(2,4-dinitroanilino)benzoic acid |
| PubChem CID | 617499 |
| Molecular Formula | C13H9N3O6 |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | 3-(2,4-dinitroanilino)benzoic acid |
| SMILES | O=C(O)c1cccc(Nc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H9N3O6/c17-13(18)8-2-1-3-9(6-8)14-11-5-4-10(15(19)20)7-12(11)16(21)22/h1-7,14H,(H,17,18) |
| InChIKey | IXLRLXCTHVMJJM-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 135.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,4-dinitroanilino)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,4-dinitroanilino)benzoic acid?
The IUPAC name of 3-(2,4-dinitroanilino)benzoic acid (CID 617499) is 3-(2,4-dinitroanilino)benzoic acid.
What is the SMILES notation for 3-(2,4-dinitroanilino)benzoic acid?
The canonical SMILES for 3-(2,4-dinitroanilino)benzoic acid is O=C(O)c1cccc(Nc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c1.
What is the InChIKey of 3-(2,4-dinitroanilino)benzoic acid?
The InChIKey is IXLRLXCTHVMJJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N3O6/c17-13(18)8-2-1-3-9(6-8)14-11-5-4-10(15(19)20)7-12(11)16(21)22/h1-7,14H,(H,17,18).
What are the key properties of 3-(2,4-dinitroanilino)benzoic acid?
3-(2,4-dinitroanilino)benzoic acid has a molecular weight of 303.23 g/mol, XLogP of 2.94, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,4-dinitroanilino)benzoic acid is sourced from PubChem (CID 617499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).