C20H18N4O — CID 617507
6-benzyl-2,6,10,17-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(17),3(8),11,13,15-pentaen-9-one (PubChem CID 617507) has the molecular formula C20H18N4O and a molecular weight of 330.39 g/mol. Its IUPAC name is 6-benzyl-2,6,10,17-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(17),3(8),11,13,15-pentaen-9-one.
| Compound Name | 6-benzyl-2,6,10,17-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(17),3(8),11,13,15-pentaen-9-one |
|---|---|
| PubChem CID | 617507 |
| Molecular Formula | C20H18N4O |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 6-benzyl-2,6,10,17-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(17),3(8),11,13,15-pentaen-9-one |
| SMILES | O=c1c2c([nH]c3nc4ccccc4n13)CCN(Cc1ccccc1)C2 |
| InChI | InChI=1S/C20H18N4O/c25-19-15-13-23(12-14-6-2-1-3-7-14)11-10-16(15)21-20-22-17-8-4-5-9-18(17)24(19)20/h1-9H,10-13H2,(H,21,22) |
| InChIKey | WBIDFOOGKFNIKK-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |