C12H18F7NO — CID 617533
N,N-dibutyl-2,2,3,3,4,4,4-heptafluorobutanamide (PubChem CID 617533) has the molecular formula C12H18F7NO and a molecular weight of 325.27 g/mol. Its IUPAC name is N,N-dibutyl-2,2,3,3,4,4,4-heptafluorobutanamide.
| Compound Name | N,N-dibutyl-2,2,3,3,4,4,4-heptafluorobutanamide |
|---|---|
| PubChem CID | 617533 |
| Molecular Formula | C12H18F7NO |
| Molecular Weight | 325.27 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | N,N-dibutyl-2,2,3,3,4,4,4-heptafluorobutanamide |
| SMILES | CCCCN(CCCC)C(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H18F7NO/c1-3-5-7-20(8-6-4-2)9(21)10(13,14)11(15,16)12(17,18)19/h3-8H2,1-2H3 |
| InChIKey | SSLBWWFVNPTUPO-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.27 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|