C14H22F7NO — CID 617537
2,2,3,3,4,4,4-heptafluoro-N,N-dipentylbutanamide (PubChem CID 617537) has the molecular formula C14H22F7NO and a molecular weight of 353.32 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-N,N-dipentylbutanamide.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-N,N-dipentylbutanamide |
|---|---|
| PubChem CID | 617537 |
| Molecular Formula | C14H22F7NO |
| Molecular Weight | 353.32 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-N,N-dipentylbutanamide |
| SMILES | CCCCCN(CCCCC)C(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H22F7NO/c1-3-5-7-9-22(10-8-6-4-2)11(23)12(15,16)13(17,18)14(19,20)21/h3-10H2,1-2H3 |
| InChIKey | QHTSBQPSSBXGHC-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.32 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|