C16H22N2O6S — CID 617551
ethyl 2-[[4-hydroxy-1-(4-methylphenyl)sulfonylpyrrolidine-2-carbonyl]amino]acetate (PubChem CID 617551) has the molecular formula C16H22N2O6S and a molecular weight of 370.43 g/mol. Its IUPAC name is ethyl 2-[[4-hydroxy-1-(4-methylphenyl)sulfonylpyrrolidine-2-carbonyl]amino]acetate.
| Compound Name | ethyl 2-[[4-hydroxy-1-(4-methylphenyl)sulfonylpyrrolidine-2-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 617551 |
| Molecular Formula | C16H22N2O6S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | ethyl 2-[[4-hydroxy-1-(4-methylphenyl)sulfonylpyrrolidine-2-carbonyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)C1CC(O)CN1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H22N2O6S/c1-3-24-15(20)9-17-16(21)14-8-12(19)10-18(14)25(22,23)13-6-4-11(2)5-7-13/h4-7,12,14,19H,3,8-10H2,1-2H3,(H,17,21) |
| InChIKey | GHKRRMNJKZWOHX-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |