C17H11F14NO3 — CID 617606
[2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-1-phenylpropyl] 2,2,3,3,4,4,4-heptafluorobutanoate (PubChem CID 617606) has the molecular formula C17H11F14NO3 and a molecular weight of 543.25 g/mol. Its IUPAC name is [2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-1-phenylpropyl] 2,2,3,3,4,4,4-heptafluorobutanoate.
| Compound Name | [2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-1-phenylpropyl] 2,2,3,3,4,4,4-heptafluorobutanoate |
|---|---|
| PubChem CID | 617606 |
| Molecular Formula | C17H11F14NO3 |
| Molecular Weight | 543.25 g/mol |
| Exact Mass | 543.05 |
| IUPAC Name | [2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-1-phenylpropyl] 2,2,3,3,4,4,4-heptafluorobutanoate |
| SMILES | CC(NC(=O)C(F)(F)C(F)(F)C(F)(F)F)C(OC(=O)C(F)(F)C(F)(F)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C17H11F14NO3/c1-7(32-10(33)12(18,19)14(22,23)16(26,27)28)9(8-5-3-2-4-6-8)35-11(34)13(20,21)15(24,25)17(29,30)31/h2-7,9H,1H3,(H,32,33) |
| InChIKey | BNYQVYZZVBQKLC-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.25 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|