C14H12N2O2 — CID 617627
1-(4-methoxy-9H-pyrido[3,4-b]indol-1-yl)ethanone (PubChem CID 617627) has the molecular formula C14H12N2O2 and a molecular weight of 240.26 g/mol. Its IUPAC name is 1-(4-methoxy-9H-pyrido[3,4-b]indol-1-yl)ethanone.
| Compound Name | 1-(4-methoxy-9H-pyrido[3,4-b]indol-1-yl)ethanone |
|---|---|
| PubChem CID | 617627 |
| Molecular Formula | C14H12N2O2 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 1-(4-methoxy-9H-pyrido[3,4-b]indol-1-yl)ethanone |
| SMILES | COc1cnc(C(C)=O)c2[nH]c3ccccc3c12 |
| InChI | InChI=1S/C14H12N2O2/c1-8(17)13-14-12(11(18-2)7-15-13)9-5-3-4-6-10(9)16-14/h3-7,16H,1-2H3 |
| InChIKey | XUJDMPJVPVPDFB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |