About 1,6-dimethoxyphenazine
1,6-dimethoxyphenazine (PubChem CID 617641) has the molecular formula C14H12N2O2
and a molecular weight of 240.26 g/mol. Its IUPAC name is 1,6-dimethoxyphenazine.
Molecular Properties
| Compound Name | 1,6-dimethoxyphenazine |
| PubChem CID | 617641 |
| Molecular Formula | C14H12N2O2 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 1,6-dimethoxyphenazine |
| SMILES | COc1cccc2nc3c(OC)cccc3nc12 |
| InChI | InChI=1S/C14H12N2O2/c1-17-11-7-3-5-9-13(11)15-10-6-4-8-12(18-2)14(10)16-9/h3-8H,1-2H3 |
| InChIKey | SFNYAHCOEPIPGO-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 1,6-dimethoxyphenazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-dimethoxyphenazine?
The IUPAC name of 1,6-dimethoxyphenazine (CID 617641) is 1,6-dimethoxyphenazine.
What is the SMILES notation for 1,6-dimethoxyphenazine?
The canonical SMILES for 1,6-dimethoxyphenazine is COc1cccc2nc3c(OC)cccc3nc12.
What is the InChIKey of 1,6-dimethoxyphenazine?
The InChIKey is SFNYAHCOEPIPGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2O2/c1-17-11-7-3-5-9-13(11)15-10-6-4-8-12(18-2)14(10)16-9/h3-8H,1-2H3.
What are the key properties of 1,6-dimethoxyphenazine?
1,6-dimethoxyphenazine has a molecular weight of 240.26 g/mol, XLogP of 2.80, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-dimethoxyphenazine is sourced from PubChem (CID 617641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).