About 6-bromo-1H-quinazoline-2,4-dione
6-bromo-1H-quinazoline-2,4-dione (PubChem CID 617686) has the molecular formula C8H5BrN2O2
and a molecular weight of 241.04 g/mol. Its IUPAC name is 6-bromo-1H-quinazoline-2,4-dione.
Molecular Properties
| Compound Name | 6-bromo-1H-quinazoline-2,4-dione |
| PubChem CID | 617686 |
| Molecular Formula | C8H5BrN2O2 |
| Molecular Weight | 241.04 g/mol |
| Exact Mass | 239.95 |
| IUPAC Name | 6-bromo-1H-quinazoline-2,4-dione |
| SMILES | O=c1[nH]c(=O)c2cc(Br)ccc2[nH]1 |
| InChI | InChI=1S/C8H5BrN2O2/c9-4-1-2-6-5(3-4)7(12)11-8(13)10-6/h1-3H,(H2,10,11,12,13) |
| InChIKey | JZDVFUAHGLJVQG-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.04 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-bromo-1H-quinazoline-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-1H-quinazoline-2,4-dione?
The IUPAC name of 6-bromo-1H-quinazoline-2,4-dione (CID 617686) is 6-bromo-1H-quinazoline-2,4-dione.
What is the SMILES notation for 6-bromo-1H-quinazoline-2,4-dione?
The canonical SMILES for 6-bromo-1H-quinazoline-2,4-dione is O=c1[nH]c(=O)c2cc(Br)ccc2[nH]1.
What is the InChIKey of 6-bromo-1H-quinazoline-2,4-dione?
The InChIKey is JZDVFUAHGLJVQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5BrN2O2/c9-4-1-2-6-5(3-4)7(12)11-8(13)10-6/h1-3H,(H2,10,11,12,13).
What are the key properties of 6-bromo-1H-quinazoline-2,4-dione?
6-bromo-1H-quinazoline-2,4-dione has a molecular weight of 241.04 g/mol, XLogP of 0.98, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-1H-quinazoline-2,4-dione is sourced from PubChem (CID 617686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).