About (NE)-5-chloro-N-(3,4-diphenyl-1,3-thiazol-2-ylidene)thiophene-2-sulfonamide
(NE)-5-chloro-N-(3,4-diphenyl-1,3-thiazol-2-ylidene)thiophene-2-sulfonamide (PubChem CID 6177119) has the molecular formula C19H13ClN2O2S3
and a molecular weight of 432.98 g/mol. Its IUPAC name is (NE)-5-chloro-N-(3,4-diphenyl-1,3-thiazol-2-ylidene)thiophene-2-sulfonamide.
Molecular Properties
| Compound Name | (NE)-5-chloro-N-(3,4-diphenyl-1,3-thiazol-2-ylidene)thiophene-2-sulfonamide |
| PubChem CID | 6177119 |
| Molecular Formula | C19H13ClN2O2S3 |
| Molecular Weight | 432.98 g/mol |
| Exact Mass | 431.98 |
| IUPAC Name | (NE)-5-chloro-N-(3,4-diphenyl-1,3-thiazol-2-ylidene)thiophene-2-sulfonamide |
| SMILES | O=S(=O)(/N=c1/scc(-c2ccccc2)n1-c1ccccc1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C19H13ClN2O2S3/c20-17-11-12-18(26-17)27(23,24)21-19-22(15-9-5-2-6-10-15)16(13-25-19)14-7-3-1-4-8-14/h1-13H/b21-19+ |
| InChIKey | ZPPMGBAVWCIJRE-XUTLUUPISA-N |
| XLogP | 5.21 |
| TPSA | 51.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.98 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|
Analyze (NE)-5-chloro-N-(3,4-diphenyl-1,3-thiazol-2-ylidene)thiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NE)-5-chloro-N-(3,4-diphenyl-1,3-thiazol-2-ylidene)thiophene-2-sulfonamide?
The IUPAC name of (NE)-5-chloro-N-(3,4-diphenyl-1,3-thiazol-2-ylidene)thiophene-2-sulfonamide (CID 6177119) is (NE)-5-chloro-N-(3,4-diphenyl-1,3-thiazol-2-ylidene)thiophene-2-sulfonamide.
What is the SMILES notation for (NE)-5-chloro-N-(3,4-diphenyl-1,3-thiazol-2-ylidene)thiophene-2-sulfonamide?
The canonical SMILES for (NE)-5-chloro-N-(3,4-diphenyl-1,3-thiazol-2-ylidene)thiophene-2-sulfonamide is O=S(=O)(/N=c1/scc(-c2ccccc2)n1-c1ccccc1)c1ccc(Cl)s1.
What is the InChIKey of (NE)-5-chloro-N-(3,4-diphenyl-1,3-thiazol-2-ylidene)thiophene-2-sulfonamide?
The InChIKey is ZPPMGBAVWCIJRE-XUTLUUPISA-N. The full InChI is InChI=1S/C19H13ClN2O2S3/c20-17-11-12-18(26-17)27(23,24)21-19-22(15-9-5-2-6-10-15)16(13-25-19)14-7-3-1-4-8-14/h1-13H/b21-19+.
What are the key properties of (NE)-5-chloro-N-(3,4-diphenyl-1,3-thiazol-2-ylidene)thiophene-2-sulfonamide?
(NE)-5-chloro-N-(3,4-diphenyl-1,3-thiazol-2-ylidene)thiophene-2-sulfonamide has a molecular weight of 432.98 g/mol, XLogP of 5.21, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (NE)-5-chloro-N-(3,4-diphenyl-1,3-thiazol-2-ylidene)thiophene-2-sulfonamide is sourced from PubChem (CID 6177119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).