C22H12F21NO6 — CID 617719
[4-[2-[2,2,3,3,4,4,4-heptafluorobutanoyl(methyl)amino]-1-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)ethyl]-2-methoxyphenyl] 2,2,3,3,4,4,4-heptafluorobutanoate (PubChem CID 617719) has the molecular formula C22H12F21NO6 and a molecular weight of 785.30 g/mol. Its IUPAC name is [4-[2-[2,2,3,3,4,4,4-heptafluorobutanoyl(methyl)amino]-1-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)ethyl]-2-methoxyphenyl] 2,2,3,3,4,4,4-heptafluorobutanoate.
| Compound Name | [4-[2-[2,2,3,3,4,4,4-heptafluorobutanoyl(methyl)amino]-1-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)ethyl]-2-methoxyphenyl] 2,2,3,3,4,4,4-heptafluorobutanoate |
|---|---|
| PubChem CID | 617719 |
| Molecular Formula | C22H12F21NO6 |
| Molecular Weight | 785.30 g/mol |
| Exact Mass | 785.03 |
| IUPAC Name | [4-[2-[2,2,3,3,4,4,4-heptafluorobutanoyl(methyl)amino]-1-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)ethyl]-2-methoxyphenyl] 2,2,3,3,4,4,4-heptafluorobutanoate |
| SMILES | COc1cc(C(CN(C)C(=O)C(F)(F)C(F)(F)C(F)(F)F)OC(=O)C(F)(F)C(F)(F)C(F)(F)F)ccc1OC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C22H12F21NO6/c1-44(11(45)14(23,24)17(29,30)20(35,36)37)6-10(50-13(47)16(27,28)19(33,34)22(41,42)43)7-3-4-8(9(5-7)48-2)49-12(46)15(25,26)18(31,32)21(38,39)40/h3-5,10H,6H2,1-2H3 |
| InChIKey | DQVQZQMDDNPFGN-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.30 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|