C28H23NO3 — CID 6177574
(E)-3-[3,4-bis(phenylmethoxy)phenyl]-1-pyridin-3-ylprop-2-en-1-one (PubChem CID 6177574) has the molecular formula C28H23NO3 and a molecular weight of 421.50 g/mol. Its IUPAC name is (E)-3-[3,4-bis(phenylmethoxy)phenyl]-1-pyridin-3-ylprop-2-en-1-one.
| Compound Name | (E)-3-[3,4-bis(phenylmethoxy)phenyl]-1-pyridin-3-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 6177574 |
| Molecular Formula | C28H23NO3 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | (E)-3-[3,4-bis(phenylmethoxy)phenyl]-1-pyridin-3-ylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(OCc2ccccc2)c(OCc2ccccc2)c1)c1cccnc1 |
| InChI | InChI=1S/C28H23NO3/c30-26(25-12-7-17-29-19-25)15-13-22-14-16-27(31-20-23-8-3-1-4-9-23)28(18-22)32-21-24-10-5-2-6-11-24/h1-19H,20-21H2/b15-13+ |
| InChIKey | PRXSRLFOGKVXEF-FYWRMAATSA-N |
| XLogP | 6.14 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|