About [(Z)-(2,3-dimethyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] 4-bromobenzenesulfonate
[(Z)-(2,3-dimethyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] 4-bromobenzenesulfonate (PubChem CID 6178031) has the molecular formula C14H12BrNO4S
and a molecular weight of 370.22 g/mol. Its IUPAC name is [(Z)-(2,3-dimethyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] 4-bromobenzenesulfonate.
Molecular Properties
| Compound Name | [(Z)-(2,3-dimethyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] 4-bromobenzenesulfonate |
| PubChem CID | 6178031 |
| Molecular Formula | C14H12BrNO4S |
| Molecular Weight | 370.22 g/mol |
| Exact Mass | 368.97 |
| IUPAC Name | [(Z)-(2,3-dimethyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] 4-bromobenzenesulfonate |
| SMILES | CC1=C(C)/C(=N\OS(=O)(=O)c2ccc(Br)cc2)C=CC1=O |
| InChI | InChI=1S/C14H12BrNO4S/c1-9-10(2)14(17)8-7-13(9)16-20-21(18,19)12-5-3-11(15)4-6-12/h3-8H,1-2H3/b16-13- |
| InChIKey | TWXUVZBDYZMFHO-SSZFMOIBSA-N |
| XLogP | 2.99 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.22 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-(2,3-dimethyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] 4-bromobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-(2,3-dimethyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] 4-bromobenzenesulfonate?
The IUPAC name of [(Z)-(2,3-dimethyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] 4-bromobenzenesulfonate (CID 6178031) is [(Z)-(2,3-dimethyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] 4-bromobenzenesulfonate.
What is the SMILES notation for [(Z)-(2,3-dimethyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] 4-bromobenzenesulfonate?
The canonical SMILES for [(Z)-(2,3-dimethyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] 4-bromobenzenesulfonate is CC1=C(C)/C(=N\OS(=O)(=O)c2ccc(Br)cc2)C=CC1=O.
What is the InChIKey of [(Z)-(2,3-dimethyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] 4-bromobenzenesulfonate?
The InChIKey is TWXUVZBDYZMFHO-SSZFMOIBSA-N. The full InChI is InChI=1S/C14H12BrNO4S/c1-9-10(2)14(17)8-7-13(9)16-20-21(18,19)12-5-3-11(15)4-6-12/h3-8H,1-2H3/b16-13-.
What are the key properties of [(Z)-(2,3-dimethyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] 4-bromobenzenesulfonate?
[(Z)-(2,3-dimethyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] 4-bromobenzenesulfonate has a molecular weight of 370.22 g/mol, XLogP of 2.99, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-(2,3-dimethyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] 4-bromobenzenesulfonate is sourced from PubChem (CID 6178031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).