C21H22N3S+ — CID 6178625
2-methyl-N-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]-1,3-benzothiazol-6-amine (PubChem CID 6178625) has the molecular formula C21H22N3S+ and a molecular weight of 348.50 g/mol. Its IUPAC name is 2-methyl-N-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]-1,3-benzothiazol-6-amine.
| Compound Name | 2-methyl-N-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 6178625 |
| Molecular Formula | C21H22N3S+ |
| Molecular Weight | 348.50 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 2-methyl-N-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]-1,3-benzothiazol-6-amine |
| SMILES | Cc1nc2ccc(N/C=C/C3=[N+](C)c4ccccc4C3(C)C)cc2s1 |
| InChI | InChI=1S/C21H21N3S/c1-14-23-17-10-9-15(13-19(17)25-14)22-12-11-20-21(2,3)16-7-5-6-8-18(16)24(20)4/h5-13H,1-4H3/p+1 |
| InChIKey | RKKMFFBDLCJFIV-UHFFFAOYSA-O |
| XLogP | 5.24 |
| TPSA | 27.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.50 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|