C9F8 — CID 617884
1,1,2,3,4,5,6,7-octafluoroindene (PubChem CID 617884) has the molecular formula C9F8 and a molecular weight of 260.08 g/mol. Its IUPAC name is 1,1,2,3,4,5,6,7-octafluoroindene.
| Compound Name | 1,1,2,3,4,5,6,7-octafluoroindene |
|---|---|
| PubChem CID | 617884 |
| Molecular Formula | C9F8 |
| Molecular Weight | 260.08 g/mol |
| Exact Mass | 259.99 |
| IUPAC Name | 1,1,2,3,4,5,6,7-octafluoroindene |
| SMILES | FC1=C(F)C(F)(F)c2c(F)c(F)c(F)c(F)c21 |
| InChI | InChI=1S/C9F8/c10-3-1-2(5(12)7(14)6(3)13)9(16,17)8(15)4(1)11 |
| InChIKey | RCYYJAWAODHLBB-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.08 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|