C15H12Br2N2O3S — CID 6179543
N-[(5E)-5-[(3,5-dibromo-2-prop-2-enoxyphenyl)methylidene]-4-oxo-1,3-thiazol-2-yl]acetamide (PubChem CID 6179543) has the molecular formula C15H12Br2N2O3S and a molecular weight of 460.15 g/mol. Its IUPAC name is N-[(5E)-5-[(3,5-dibromo-2-prop-2-enoxyphenyl)methylidene]-4-oxo-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[(5E)-5-[(3,5-dibromo-2-prop-2-enoxyphenyl)methylidene]-4-oxo-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 6179543 |
| Molecular Formula | C15H12Br2N2O3S |
| Molecular Weight | 460.15 g/mol |
| Exact Mass | 457.89 |
| IUPAC Name | N-[(5E)-5-[(3,5-dibromo-2-prop-2-enoxyphenyl)methylidene]-4-oxo-1,3-thiazol-2-yl]acetamide |
| SMILES | C=CCOc1c(Br)cc(Br)cc1/C=C1/SC(NC(C)=O)=NC1=O |
| InChI | InChI=1S/C15H12Br2N2O3S/c1-3-4-22-13-9(5-10(16)7-11(13)17)6-12-14(21)19-15(23-12)18-8(2)20/h3,5-7H,1,4H2,2H3,(H,18,19,20,21)/b12-6+ |
| InChIKey | VPPHCMCZQGTONJ-WUXMJOGZSA-N |
| XLogP | 3.88 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.15 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|